C23H21N3O5 — CID 166797451
(3S)-2-(hydroxymethyl)-6-[2-[5-(1H-indol-6-yl)-1H-indazol-7-yl]ethynyl]oxane-3,4,5-triol (PubChem CID 166797451) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is (3S)-2-(hydroxymethyl)-6-[2-[5-(1H-indol-6-yl)-1H-indazol-7-yl]ethynyl]oxane-3,4,5-triol.
| Compound Name | (3S)-2-(hydroxymethyl)-6-[2-[5-(1H-indol-6-yl)-1H-indazol-7-yl]ethynyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 166797451 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | (3S)-2-(hydroxymethyl)-6-[2-[5-(1H-indol-6-yl)-1H-indazol-7-yl]ethynyl]oxane-3,4,5-triol |
| SMILES | OCC1OC(C#Cc2cc(-c3ccc4cc[nH]c4c3)cc3cn[nH]c23)C(O)C(O)[C@@H]1O |
| InChI | InChI=1S/C23H21N3O5/c27-11-19-22(29)23(30)21(28)18(31-19)4-3-14-7-15(8-16-10-25-26-20(14)16)13-2-1-12-5-6-24-17(12)9-13/h1-2,5-10,18-19,21-24,27-30H,11H2,(H,25,26)/t18?,19?,21?,22-,23?/m1/s1 |
| InChIKey | NRLDRCGSQXLEOA-YDNPFFLPSA-N |
| XLogP | 0.91 |
| TPSA | 134.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|