About 2,5-bis(4-methoxyphenyl)-4-methyl-3-[4-(4-methylphenyl)phenyl]-2,4-dihydroimidazole
2,5-bis(4-methoxyphenyl)-4-methyl-3-[4-(4-methylphenyl)phenyl]-2,4-dihydroimidazole (PubChem CID 166797832) has the molecular formula C31H30N2O2
and a molecular weight of 462.59 g/mol. Its IUPAC name is 2,5-bis(4-methoxyphenyl)-4-methyl-3-[4-(4-methylphenyl)phenyl]-2,4-dihydroimidazole.
Molecular Properties
| Compound Name | 2,5-bis(4-methoxyphenyl)-4-methyl-3-[4-(4-methylphenyl)phenyl]-2,4-dihydroimidazole |
| PubChem CID | 166797832 |
| Molecular Formula | C31H30N2O2 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 2,5-bis(4-methoxyphenyl)-4-methyl-3-[4-(4-methylphenyl)phenyl]-2,4-dihydroimidazole |
| SMILES | COc1ccc(C2=NC(c3ccc(OC)cc3)N(c3ccc(-c4ccc(C)cc4)cc3)C2C)cc1 |
| InChI | InChI=1S/C31H30N2O2/c1-21-5-7-23(8-6-21)24-9-15-27(16-10-24)33-22(2)30(25-11-17-28(34-3)18-12-25)32-31(33)26-13-19-29(35-4)20-14-26/h5-20,22,31H,1-4H3 |
| InChIKey | DYZCHWJMFPIGNB-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-bis(4-methoxyphenyl)-4-methyl-3-[4-(4-methylphenyl)phenyl]-2,4-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(4-methoxyphenyl)-4-methyl-3-[4-(4-methylphenyl)phenyl]-2,4-dihydroimidazole?
The IUPAC name of 2,5-bis(4-methoxyphenyl)-4-methyl-3-[4-(4-methylphenyl)phenyl]-2,4-dihydroimidazole (CID 166797832) is 2,5-bis(4-methoxyphenyl)-4-methyl-3-[4-(4-methylphenyl)phenyl]-2,4-dihydroimidazole.
What is the SMILES notation for 2,5-bis(4-methoxyphenyl)-4-methyl-3-[4-(4-methylphenyl)phenyl]-2,4-dihydroimidazole?
The canonical SMILES for 2,5-bis(4-methoxyphenyl)-4-methyl-3-[4-(4-methylphenyl)phenyl]-2,4-dihydroimidazole is COc1ccc(C2=NC(c3ccc(OC)cc3)N(c3ccc(-c4ccc(C)cc4)cc3)C2C)cc1.
What is the InChIKey of 2,5-bis(4-methoxyphenyl)-4-methyl-3-[4-(4-methylphenyl)phenyl]-2,4-dihydroimidazole?
The InChIKey is DYZCHWJMFPIGNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H30N2O2/c1-21-5-7-23(8-6-21)24-9-15-27(16-10-24)33-22(2)30(25-11-17-28(34-3)18-12-25)32-31(33)26-13-19-29(35-4)20-14-26/h5-20,22,31H,1-4H3.
What are the key properties of 2,5-bis(4-methoxyphenyl)-4-methyl-3-[4-(4-methylphenyl)phenyl]-2,4-dihydroimidazole?
2,5-bis(4-methoxyphenyl)-4-methyl-3-[4-(4-methylphenyl)phenyl]-2,4-dihydroimidazole has a molecular weight of 462.59 g/mol, XLogP of 7.08, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(4-methoxyphenyl)-4-methyl-3-[4-(4-methylphenyl)phenyl]-2,4-dihydroimidazole is sourced from PubChem (CID 166797832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).