C17H29F2N — CID 166798108
N-[(3E)-4-(1,1-difluoroethyl)-2,6-dimethylhepta-3,5-dien-3-yl]-3-methylpentan-2-imine (PubChem CID 166798108) has the molecular formula C17H29F2N and a molecular weight of 285.42 g/mol. Its IUPAC name is N-[(3E)-4-(1,1-difluoroethyl)-2,6-dimethylhepta-3,5-dien-3-yl]-3-methylpentan-2-imine.
| Compound Name | N-[(3E)-4-(1,1-difluoroethyl)-2,6-dimethylhepta-3,5-dien-3-yl]-3-methylpentan-2-imine |
|---|---|
| PubChem CID | 166798108 |
| Molecular Formula | C17H29F2N |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | N-[(3E)-4-(1,1-difluoroethyl)-2,6-dimethylhepta-3,5-dien-3-yl]-3-methylpentan-2-imine |
| SMILES | CCC(C)/C(C)=N/C(=C(\C=C(C)C)C(C)(F)F)C(C)C |
| InChI | InChI=1S/C17H29F2N/c1-9-13(6)14(7)20-16(12(4)5)15(10-11(2)3)17(8,18)19/h10,12-13H,9H2,1-8H3/b16-15+,20-14+ |
| InChIKey | TYTJHATUZLBOCY-CVRJQCRJSA-N |
| XLogP | 6.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|