C24H26N2OS — CID 166798444
3-methyl-7-(methylsulfanylamino)-6-[(3-phenylphenyl)methyl]-6,7,8,9-tetrahydroquinolizin-4-one (PubChem CID 166798444) has the molecular formula C24H26N2OS and a molecular weight of 390.55 g/mol. Its IUPAC name is 3-methyl-7-(methylsulfanylamino)-6-[(3-phenylphenyl)methyl]-6,7,8,9-tetrahydroquinolizin-4-one.
| Compound Name | 3-methyl-7-(methylsulfanylamino)-6-[(3-phenylphenyl)methyl]-6,7,8,9-tetrahydroquinolizin-4-one |
|---|---|
| PubChem CID | 166798444 |
| Molecular Formula | C24H26N2OS |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 3-methyl-7-(methylsulfanylamino)-6-[(3-phenylphenyl)methyl]-6,7,8,9-tetrahydroquinolizin-4-one |
| SMILES | CSNC1CCc2ccc(C)c(=O)n2C1Cc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C24H26N2OS/c1-17-11-12-21-13-14-22(25-28-2)23(26(21)24(17)27)16-18-7-6-10-20(15-18)19-8-4-3-5-9-19/h3-12,15,22-23,25H,13-14,16H2,1-2H3 |
| InChIKey | GOVNCTSTZQKONV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|