C23H23FN2OS — CID 166798591
3-fluoro-7-(methylsulfanylamino)-6-[(3-phenylphenyl)methyl]-6,7,8,9-tetrahydroquinolizin-4-one (PubChem CID 166798591) has the molecular formula C23H23FN2OS and a molecular weight of 394.52 g/mol. Its IUPAC name is 3-fluoro-7-(methylsulfanylamino)-6-[(3-phenylphenyl)methyl]-6,7,8,9-tetrahydroquinolizin-4-one.
| Compound Name | 3-fluoro-7-(methylsulfanylamino)-6-[(3-phenylphenyl)methyl]-6,7,8,9-tetrahydroquinolizin-4-one |
|---|---|
| PubChem CID | 166798591 |
| Molecular Formula | C23H23FN2OS |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 3-fluoro-7-(methylsulfanylamino)-6-[(3-phenylphenyl)methyl]-6,7,8,9-tetrahydroquinolizin-4-one |
| SMILES | CSNC1CCc2ccc(F)c(=O)n2C1Cc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C23H23FN2OS/c1-28-25-21-13-11-19-10-12-20(24)23(27)26(19)22(21)15-16-6-5-9-18(14-16)17-7-3-2-4-8-17/h2-10,12,14,21-22,25H,11,13,15H2,1H3 |
| InChIKey | FXKWULVDHODFTQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|