C18H18O4 — CID 166798792
2-[[4-[4-(ethoxymethoxy)phenyl]cyclohexa-1,2,3,5-tetraen-1-yl]oxymethyl]oxirane (PubChem CID 166798792) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-[[4-[4-(ethoxymethoxy)phenyl]cyclohexa-1,2,3,5-tetraen-1-yl]oxymethyl]oxirane.
| Compound Name | 2-[[4-[4-(ethoxymethoxy)phenyl]cyclohexa-1,2,3,5-tetraen-1-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 166798792 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-[[4-[4-(ethoxymethoxy)phenyl]cyclohexa-1,2,3,5-tetraen-1-yl]oxymethyl]oxirane |
| SMILES | CCOCOc1ccc(C2=C=C=C(OCC3CO3)C=C2)cc1 |
| InChI | InChI=1S/C18H18O4/c1-2-19-13-22-17-9-5-15(6-10-17)14-3-7-16(8-4-14)20-11-18-12-21-18/h3,5-7,9-10,18H,2,11-13H2,1H3 |
| InChIKey | GAAJPLATIZQBIJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|