About (5S)-5-fluoro-3-methyl-1,3-thiazolidine
(5S)-5-fluoro-3-methyl-1,3-thiazolidine (PubChem CID 166798904) has the molecular formula C4H8FNS
and a molecular weight of 121.18 g/mol. Its IUPAC name is (5S)-5-fluoro-3-methyl-1,3-thiazolidine.
Molecular Properties
| Compound Name | (5S)-5-fluoro-3-methyl-1,3-thiazolidine |
| PubChem CID | 166798904 |
| Molecular Formula | C4H8FNS |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.04 |
| IUPAC Name | (5S)-5-fluoro-3-methyl-1,3-thiazolidine |
| SMILES | CN1CS[C@H](F)C1 |
| InChI | InChI=1S/C4H8FNS/c1-6-2-4(5)7-3-6/h4H,2-3H2,1H3/t4-/m0/s1 |
| InChIKey | GSNZJYGAWZWRRE-BYPYZUCNSA-N |
| XLogP | 0.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-5-fluoro-3-methyl-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-fluoro-3-methyl-1,3-thiazolidine?
The IUPAC name of (5S)-5-fluoro-3-methyl-1,3-thiazolidine (CID 166798904) is (5S)-5-fluoro-3-methyl-1,3-thiazolidine.
What is the SMILES notation for (5S)-5-fluoro-3-methyl-1,3-thiazolidine?
The canonical SMILES for (5S)-5-fluoro-3-methyl-1,3-thiazolidine is CN1CS[C@H](F)C1.
What is the InChIKey of (5S)-5-fluoro-3-methyl-1,3-thiazolidine?
The InChIKey is GSNZJYGAWZWRRE-BYPYZUCNSA-N. The full InChI is InChI=1S/C4H8FNS/c1-6-2-4(5)7-3-6/h4H,2-3H2,1H3/t4-/m0/s1.
What are the key properties of (5S)-5-fluoro-3-methyl-1,3-thiazolidine?
(5S)-5-fluoro-3-methyl-1,3-thiazolidine has a molecular weight of 121.18 g/mol, XLogP of 0.92, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-fluoro-3-methyl-1,3-thiazolidine is sourced from PubChem (CID 166798904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).