C14H15N5O2 — CID 16679907
1-[3-(6-morpholin-4-yl-1,2,4,5-tetrazin-3-yl)phenyl]ethanone (PubChem CID 16679907) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 1-[3-(6-morpholin-4-yl-1,2,4,5-tetrazin-3-yl)phenyl]ethanone.
| Compound Name | 1-[3-(6-morpholin-4-yl-1,2,4,5-tetrazin-3-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 16679907 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1-[3-(6-morpholin-4-yl-1,2,4,5-tetrazin-3-yl)phenyl]ethanone |
| SMILES | CC(=O)c1cccc(-c2nnc(N3CCOCC3)nn2)c1 |
| InChI | InChI=1S/C14H15N5O2/c1-10(20)11-3-2-4-12(9-11)13-15-17-14(18-16-13)19-5-7-21-8-6-19/h2-4,9H,5-8H2,1H3 |
| InChIKey | VFQPBKFAXDGPIM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 81.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |