C22H38N2O3 — CID 166799740
8-(2,5-dioxopyrrol-1-yl)-N-hexan-2-yl-4,4,6,6-tetramethyloctanamide (PubChem CID 166799740) has the molecular formula C22H38N2O3 and a molecular weight of 378.56 g/mol. Its IUPAC name is 8-(2,5-dioxopyrrol-1-yl)-N-hexan-2-yl-4,4,6,6-tetramethyloctanamide.
| Compound Name | 8-(2,5-dioxopyrrol-1-yl)-N-hexan-2-yl-4,4,6,6-tetramethyloctanamide |
|---|---|
| PubChem CID | 166799740 |
| Molecular Formula | C22H38N2O3 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.29 |
| IUPAC Name | 8-(2,5-dioxopyrrol-1-yl)-N-hexan-2-yl-4,4,6,6-tetramethyloctanamide |
| SMILES | CCCCC(C)NC(=O)CCC(C)(C)CC(C)(C)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C22H38N2O3/c1-7-8-9-17(2)23-18(25)12-13-21(3,4)16-22(5,6)14-15-24-19(26)10-11-20(24)27/h10-11,17H,7-9,12-16H2,1-6H3,(H,23,25) |
| InChIKey | UZMUMBRJYGZZCV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|