About (5Z)-N,2-dimethylocta-5,7-dien-4-amine
(5Z)-N,2-dimethylocta-5,7-dien-4-amine (PubChem CID 166800331) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is (5Z)-N,2-dimethylocta-5,7-dien-4-amine.
Molecular Properties
| Compound Name | (5Z)-N,2-dimethylocta-5,7-dien-4-amine |
| PubChem CID | 166800331 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | (5Z)-N,2-dimethylocta-5,7-dien-4-amine |
| SMILES | C=C/C=C\C(CC(C)C)NC |
| InChI | InChI=1S/C10H19N/c1-5-6-7-10(11-4)8-9(2)3/h5-7,9-11H,1,8H2,2-4H3/b7-6- |
| InChIKey | SXXVYAZZWDLHGU-SREVYHEPSA-N |
| XLogP | 2.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-N,2-dimethylocta-5,7-dien-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-N,2-dimethylocta-5,7-dien-4-amine?
The IUPAC name of (5Z)-N,2-dimethylocta-5,7-dien-4-amine (CID 166800331) is (5Z)-N,2-dimethylocta-5,7-dien-4-amine.
What is the SMILES notation for (5Z)-N,2-dimethylocta-5,7-dien-4-amine?
The canonical SMILES for (5Z)-N,2-dimethylocta-5,7-dien-4-amine is C=C/C=C\C(CC(C)C)NC.
What is the InChIKey of (5Z)-N,2-dimethylocta-5,7-dien-4-amine?
The InChIKey is SXXVYAZZWDLHGU-SREVYHEPSA-N. The full InChI is InChI=1S/C10H19N/c1-5-6-7-10(11-4)8-9(2)3/h5-7,9-11H,1,8H2,2-4H3/b7-6-.
What are the key properties of (5Z)-N,2-dimethylocta-5,7-dien-4-amine?
(5Z)-N,2-dimethylocta-5,7-dien-4-amine has a molecular weight of 153.27 g/mol, XLogP of 2.36, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-N,2-dimethylocta-5,7-dien-4-amine is sourced from PubChem (CID 166800331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).