About N-[[(2R,3R)-3-[5-(disulfanyl)pentyl]-4-methylmorpholin-2-yl]methyl]-N-methylethanamine
N-[[(2R,3R)-3-[5-(disulfanyl)pentyl]-4-methylmorpholin-2-yl]methyl]-N-methylethanamine (PubChem CID 166800500) has the molecular formula C14H30N2OS2
and a molecular weight of 306.54 g/mol. Its IUPAC name is N-[[(2R,3R)-3-[5-(disulfanyl)pentyl]-4-methylmorpholin-2-yl]methyl]-N-methylethanamine.
Molecular Properties
| Compound Name | N-[[(2R,3R)-3-[5-(disulfanyl)pentyl]-4-methylmorpholin-2-yl]methyl]-N-methylethanamine |
| PubChem CID | 166800500 |
| Molecular Formula | C14H30N2OS2 |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | N-[[(2R,3R)-3-[5-(disulfanyl)pentyl]-4-methylmorpholin-2-yl]methyl]-N-methylethanamine |
| SMILES | CCN(C)C[C@H]1OCCN(C)[C@@H]1CCCCCSS |
| InChI | InChI=1S/C14H30N2OS2/c1-4-15(2)12-14-13(16(3)9-10-17-14)8-6-5-7-11-19-18/h13-14,18H,4-12H2,1-3H3/t13-,14-/m1/s1 |
| InChIKey | DEXCQWFRQNREGD-ZIAGYGMSSA-N |
| XLogP | 2.78 |
| TPSA | 15.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-[[(2R,3R)-3-[5-(disulfanyl)pentyl]-4-methylmorpholin-2-yl]methyl]-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(2R,3R)-3-[5-(disulfanyl)pentyl]-4-methylmorpholin-2-yl]methyl]-N-methylethanamine?
The IUPAC name of N-[[(2R,3R)-3-[5-(disulfanyl)pentyl]-4-methylmorpholin-2-yl]methyl]-N-methylethanamine (CID 166800500) is N-[[(2R,3R)-3-[5-(disulfanyl)pentyl]-4-methylmorpholin-2-yl]methyl]-N-methylethanamine.
What is the SMILES notation for N-[[(2R,3R)-3-[5-(disulfanyl)pentyl]-4-methylmorpholin-2-yl]methyl]-N-methylethanamine?
The canonical SMILES for N-[[(2R,3R)-3-[5-(disulfanyl)pentyl]-4-methylmorpholin-2-yl]methyl]-N-methylethanamine is CCN(C)C[C@H]1OCCN(C)[C@@H]1CCCCCSS.
What is the InChIKey of N-[[(2R,3R)-3-[5-(disulfanyl)pentyl]-4-methylmorpholin-2-yl]methyl]-N-methylethanamine?
The InChIKey is DEXCQWFRQNREGD-ZIAGYGMSSA-N. The full InChI is InChI=1S/C14H30N2OS2/c1-4-15(2)12-14-13(16(3)9-10-17-14)8-6-5-7-11-19-18/h13-14,18H,4-12H2,1-3H3/t13-,14-/m1/s1.
What are the key properties of N-[[(2R,3R)-3-[5-(disulfanyl)pentyl]-4-methylmorpholin-2-yl]methyl]-N-methylethanamine?
N-[[(2R,3R)-3-[5-(disulfanyl)pentyl]-4-methylmorpholin-2-yl]methyl]-N-methylethanamine has a molecular weight of 306.54 g/mol, XLogP of 2.78, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(2R,3R)-3-[5-(disulfanyl)pentyl]-4-methylmorpholin-2-yl]methyl]-N-methylethanamine is sourced from PubChem (CID 166800500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).