C24H26ClNO5 — CID 16680069
(1R,4R,5S)-4-(2-chloroethyl)-2-[(4-methoxyphenyl)methyl]-5-methyl-1-(phenylmethoxymethyl)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 16680069) has the molecular formula C24H26ClNO5 and a molecular weight of 443.93 g/mol. Its IUPAC name is (1R,4R,5S)-4-(2-chloroethyl)-2-[(4-methoxyphenyl)methyl]-5-methyl-1-(phenylmethoxymethyl)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | (1R,4R,5S)-4-(2-chloroethyl)-2-[(4-methoxyphenyl)methyl]-5-methyl-1-(phenylmethoxymethyl)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 16680069 |
| Molecular Formula | C24H26ClNO5 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | (1R,4R,5S)-4-(2-chloroethyl)-2-[(4-methoxyphenyl)methyl]-5-methyl-1-(phenylmethoxymethyl)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | COc1ccc(CN2C(=O)[C@H](CCCl)[C@]3(C)OC(=O)[C@]23COCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H26ClNO5/c1-23-20(12-13-25)21(27)26(14-17-8-10-19(29-2)11-9-17)24(23,22(28)31-23)16-30-15-18-6-4-3-5-7-18/h3-11,20H,12-16H2,1-2H3/t20-,23-,24-/m0/s1 |
| InChIKey | FMDCSCCEPCSRQX-OYDLWJJNSA-N |
| XLogP | 3.55 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|