C20H14ClN3S — CID 16680184
12-thia-1,3-diaza-21-azoniahexacyclo[11.10.1.02,11.04,9.015,20.021,24]tetracosa-2,4,6,8,10,13,15,17,19,21(24)-decaene chloride (PubChem CID 16680184) has the molecular formula C20H14ClN3S and a molecular weight of 363.87 g/mol. Its IUPAC name is 12-thia-1,3-diaza-21-azoniahexacyclo[11.10.1.02,11.04,9.015,20.021,24]tetracosa-2,4,6,8,10,13,15,17,19,21(24)-decaene chloride.
| Compound Name | 12-thia-1,3-diaza-21-azoniahexacyclo[11.10.1.02,11.04,9.015,20.021,24]tetracosa-2,4,6,8,10,13,15,17,19,21(24)-decaene chloride |
|---|---|
| PubChem CID | 16680184 |
| Molecular Formula | C20H14ClN3S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 12-thia-1,3-diaza-21-azoniahexacyclo[11.10.1.02,11.04,9.015,20.021,24]tetracosa-2,4,6,8,10,13,15,17,19,21(24)-decaene chloride |
| SMILES | [Cl-].c1ccc2nc3c(cc2c1)Sc1cc2ccccc2[n+]2c1N3CC2 |
| InChI | InChI=1S/C20H14N3S.ClH/c1-3-7-15-13(5-1)11-17-19(21-15)23-10-9-22-16-8-4-2-6-14(16)12-18(24-17)20(22)23;/h1-8,11-12H,9-10H2;1H/q+1;/p-1 |
| InChIKey | WXRYUBHDCNNDGA-UHFFFAOYSA-M |
| XLogP | 1.30 |
| TPSA | 20.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|