About 5-(2,2-difluorocyclopropyl)-1H-pyrazole-3-carbohydrazide
5-(2,2-difluorocyclopropyl)-1H-pyrazole-3-carbohydrazide (PubChem CID 166803138) has the molecular formula C7H8F2N4O
and a molecular weight of 202.16 g/mol. Its IUPAC name is 5-(2,2-difluorocyclopropyl)-1H-pyrazole-3-carbohydrazide.
Molecular Properties
| Compound Name | 5-(2,2-difluorocyclopropyl)-1H-pyrazole-3-carbohydrazide |
| PubChem CID | 166803138 |
| Molecular Formula | C7H8F2N4O |
| Molecular Weight | 202.16 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 5-(2,2-difluorocyclopropyl)-1H-pyrazole-3-carbohydrazide |
| SMILES | NNC(=O)c1cc(C2CC2(F)F)[nH]n1 |
| InChI | InChI=1S/C7H8F2N4O/c8-7(9)2-3(7)4-1-5(13-12-4)6(14)11-10/h1,3H,2,10H2,(H,11,14)(H,12,13) |
| InChIKey | SWDMOSVNOBBDHD-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.16 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,2-difluorocyclopropyl)-1H-pyrazole-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-difluorocyclopropyl)-1H-pyrazole-3-carbohydrazide?
The IUPAC name of 5-(2,2-difluorocyclopropyl)-1H-pyrazole-3-carbohydrazide (CID 166803138) is 5-(2,2-difluorocyclopropyl)-1H-pyrazole-3-carbohydrazide.
What is the SMILES notation for 5-(2,2-difluorocyclopropyl)-1H-pyrazole-3-carbohydrazide?
The canonical SMILES for 5-(2,2-difluorocyclopropyl)-1H-pyrazole-3-carbohydrazide is NNC(=O)c1cc(C2CC2(F)F)[nH]n1.
What is the InChIKey of 5-(2,2-difluorocyclopropyl)-1H-pyrazole-3-carbohydrazide?
The InChIKey is SWDMOSVNOBBDHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2N4O/c8-7(9)2-3(7)4-1-5(13-12-4)6(14)11-10/h1,3H,2,10H2,(H,11,14)(H,12,13).
What are the key properties of 5-(2,2-difluorocyclopropyl)-1H-pyrazole-3-carbohydrazide?
5-(2,2-difluorocyclopropyl)-1H-pyrazole-3-carbohydrazide has a molecular weight of 202.16 g/mol, XLogP of 0.14, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-difluorocyclopropyl)-1H-pyrazole-3-carbohydrazide is sourced from PubChem (CID 166803138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).