C28H48N2 — CID 166803926
N'-[(2E,4E,5Z)-8-tert-butyl-7,10,10-trimethyl-4-prop-2-enylideneundeca-2,5-dien-3-yl]-N-(3-methylbuta-1,3-dien-2-yl)ethane-1,2-diamine (PubChem CID 166803926) has the molecular formula C28H48N2 and a molecular weight of 412.71 g/mol. Its IUPAC name is N'-[(2E,4E,5Z)-8-tert-butyl-7,10,10-trimethyl-4-prop-2-enylideneundeca-2,5-dien-3-yl]-N-(3-methylbuta-1,3-dien-2-yl)ethane-1,2-diamine.
| Compound Name | N'-[(2E,4E,5Z)-8-tert-butyl-7,10,10-trimethyl-4-prop-2-enylideneundeca-2,5-dien-3-yl]-N-(3-methylbuta-1,3-dien-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 166803926 |
| Molecular Formula | C28H48N2 |
| Molecular Weight | 412.71 g/mol |
| Exact Mass | 412.38 |
| IUPAC Name | N'-[(2E,4E,5Z)-8-tert-butyl-7,10,10-trimethyl-4-prop-2-enylideneundeca-2,5-dien-3-yl]-N-(3-methylbuta-1,3-dien-2-yl)ethane-1,2-diamine |
| SMILES | C=C/C=C(\C=C/C(C)C(CC(C)(C)C)C(C)(C)C)C(=C\C)/NCCNC(=C)C(=C)C |
| InChI | InChI=1S/C28H48N2/c1-13-15-24(26(14-2)30-19-18-29-23(6)21(3)4)17-16-22(5)25(28(10,11)12)20-27(7,8)9/h13-17,22,25,29-30H,1,3,6,18-20H2,2,4-5,7-12H3/b17-16-,24-15+,26-14+ |
| InChIKey | YUHXMDLBJKLJHX-WJWJPLNYSA-N |
| XLogP | 7.56 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.71 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|