About N-ethyl-N'-[1-(6-methylcyclohexa-1,3-dien-1-yl)ethyl]methanediamine
N-ethyl-N'-[1-(6-methylcyclohexa-1,3-dien-1-yl)ethyl]methanediamine (PubChem CID 166804055) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is N-ethyl-N'-[1-(6-methylcyclohexa-1,3-dien-1-yl)ethyl]methanediamine.
Molecular Properties
| Compound Name | N-ethyl-N'-[1-(6-methylcyclohexa-1,3-dien-1-yl)ethyl]methanediamine |
| PubChem CID | 166804055 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | N-ethyl-N'-[1-(6-methylcyclohexa-1,3-dien-1-yl)ethyl]methanediamine |
| SMILES | CCNCNC(C)C1=CC=CCC1C |
| InChI | InChI=1S/C12H22N2/c1-4-13-9-14-11(3)12-8-6-5-7-10(12)2/h5-6,8,10-11,13-14H,4,7,9H2,1-3H3 |
| InChIKey | RIAYQESNDBIQHQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N'-[1-(6-methylcyclohexa-1,3-dien-1-yl)ethyl]methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N'-[1-(6-methylcyclohexa-1,3-dien-1-yl)ethyl]methanediamine?
The IUPAC name of N-ethyl-N'-[1-(6-methylcyclohexa-1,3-dien-1-yl)ethyl]methanediamine (CID 166804055) is N-ethyl-N'-[1-(6-methylcyclohexa-1,3-dien-1-yl)ethyl]methanediamine.
What is the SMILES notation for N-ethyl-N'-[1-(6-methylcyclohexa-1,3-dien-1-yl)ethyl]methanediamine?
The canonical SMILES for N-ethyl-N'-[1-(6-methylcyclohexa-1,3-dien-1-yl)ethyl]methanediamine is CCNCNC(C)C1=CC=CCC1C.
What is the InChIKey of N-ethyl-N'-[1-(6-methylcyclohexa-1,3-dien-1-yl)ethyl]methanediamine?
The InChIKey is RIAYQESNDBIQHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2/c1-4-13-9-14-11(3)12-8-6-5-7-10(12)2/h5-6,8,10-11,13-14H,4,7,9H2,1-3H3.
What are the key properties of N-ethyl-N'-[1-(6-methylcyclohexa-1,3-dien-1-yl)ethyl]methanediamine?
N-ethyl-N'-[1-(6-methylcyclohexa-1,3-dien-1-yl)ethyl]methanediamine has a molecular weight of 194.32 g/mol, XLogP of 2.05, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N'-[1-(6-methylcyclohexa-1,3-dien-1-yl)ethyl]methanediamine is sourced from PubChem (CID 166804055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).