C33H32N2O2 — CID 16680455
4-[(R)-[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-phenanthren-9-yloxymethyl]quinolin-6-ol (PubChem CID 16680455) has the molecular formula C33H32N2O2 and a molecular weight of 488.63 g/mol. Its IUPAC name is 4-[(R)-[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-phenanthren-9-yloxymethyl]quinolin-6-ol.
| Compound Name | 4-[(R)-[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-phenanthren-9-yloxymethyl]quinolin-6-ol |
|---|---|
| PubChem CID | 16680455 |
| Molecular Formula | C33H32N2O2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 4-[(R)-[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-phenanthren-9-yloxymethyl]quinolin-6-ol |
| SMILES | CC[C@H]1CN2CC[C@H]1C[C@@H]2[C@H](Oc1cc2ccccc2c2ccccc12)c1ccnc2ccc(O)cc12 |
| InChI | InChI=1S/C33H32N2O2/c1-2-21-20-35-16-14-22(21)17-31(35)33(28-13-15-34-30-12-11-24(36)19-29(28)30)37-32-18-23-7-3-4-8-25(23)26-9-5-6-10-27(26)32/h3-13,15,18-19,21-22,31,33,36H,2,14,16-17,20H2,1H3/t21-,22-,31+,33+/m0/s1 |
| InChIKey | OVOHVXCZSNSNOD-UYYRXMEJSA-N |
| XLogP | 7.49 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|