About [2-(2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-2-oxoethyl]urea
[2-(2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-2-oxoethyl]urea (PubChem CID 166804685) has the molecular formula C13H24N4O2
and a molecular weight of 268.36 g/mol. Its IUPAC name is [2-(2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-2-oxoethyl]urea.
Molecular Properties
| Compound Name | [2-(2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-2-oxoethyl]urea |
| PubChem CID | 166804685 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | [2-(2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-2-oxoethyl]urea |
| SMILES | CN1CCCC2(CCN(C(=O)CNC(N)=O)CC2)C1 |
| InChI | InChI=1S/C13H24N4O2/c1-16-6-2-3-13(10-16)4-7-17(8-5-13)11(18)9-15-12(14)19/h2-10H2,1H3,(H3,14,15,19) |
| InChIKey | JFRRRSHUOAHFCY-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-2-oxoethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-2-oxoethyl]urea?
The IUPAC name of [2-(2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-2-oxoethyl]urea (CID 166804685) is [2-(2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-2-oxoethyl]urea.
What is the SMILES notation for [2-(2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-2-oxoethyl]urea?
The canonical SMILES for [2-(2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-2-oxoethyl]urea is CN1CCCC2(CCN(C(=O)CNC(N)=O)CC2)C1.
What is the InChIKey of [2-(2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-2-oxoethyl]urea?
The InChIKey is JFRRRSHUOAHFCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N4O2/c1-16-6-2-3-13(10-16)4-7-17(8-5-13)11(18)9-15-12(14)19/h2-10H2,1H3,(H3,14,15,19).
What are the key properties of [2-(2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-2-oxoethyl]urea?
[2-(2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-2-oxoethyl]urea has a molecular weight of 268.36 g/mol, XLogP of -0.01, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-2-oxoethyl]urea is sourced from PubChem (CID 166804685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).