C7H12N2O5S — CID 166804689
(3-methyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate (PubChem CID 166804689) has the molecular formula C7H12N2O5S and a molecular weight of 236.25 g/mol. Its IUPAC name is (3-methyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate.
| Compound Name | (3-methyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 166804689 |
| Molecular Formula | C7H12N2O5S |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | (3-methyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate |
| SMILES | CC1CC2CN(C1)C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C7H12N2O5S/c1-5-2-6-4-8(3-5)7(10)9(6)14-15(11,12)13/h5-6H,2-4H2,1H3,(H,11,12,13) |
| InChIKey | YJFAHAXTHAPPBP-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|