C19H29N — CID 166804761
1-[6-[(5Z)-4-methylhepta-2,5-dien-4-yl]cyclohexa-1,3-dien-1-yl]-N-propan-2-ylethanimine (PubChem CID 166804761) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is 1-[6-[(5Z)-4-methylhepta-2,5-dien-4-yl]cyclohexa-1,3-dien-1-yl]-N-propan-2-ylethanimine.
| Compound Name | 1-[6-[(5Z)-4-methylhepta-2,5-dien-4-yl]cyclohexa-1,3-dien-1-yl]-N-propan-2-ylethanimine |
|---|---|
| PubChem CID | 166804761 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 1-[6-[(5Z)-4-methylhepta-2,5-dien-4-yl]cyclohexa-1,3-dien-1-yl]-N-propan-2-ylethanimine |
| SMILES | CC=CC(C)(/C=C\C)C1CC=CC=C1/C(C)=N/C(C)C |
| InChI | InChI=1S/C19H29N/c1-7-13-19(6,14-8-2)18-12-10-9-11-17(18)16(5)20-15(3)4/h7-11,13-15,18H,12H2,1-6H3/b13-7-,14-8?,20-16+ |
| InChIKey | DGXXOYBOENVNJK-KGTXSSOMSA-N |
| XLogP | 5.52 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|