C9H14N2 — CID 166805466
2-methyl-1,4,4a,5,6,7-hexahydro-1,8-naphthyridine (PubChem CID 166805466) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-methyl-1,4,4a,5,6,7-hexahydro-1,8-naphthyridine.
| Compound Name | 2-methyl-1,4,4a,5,6,7-hexahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 166805466 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2-methyl-1,4,4a,5,6,7-hexahydro-1,8-naphthyridine |
| SMILES | CC1=CCC2CCCN=C2N1 |
| InChI | InChI=1S/C9H14N2/c1-7-4-5-8-3-2-6-10-9(8)11-7/h4,8H,2-3,5-6H2,1H3,(H,10,11) |
| InChIKey | UBHYZXWLHYQAKY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |