About tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-1-(3-chlorophenyl)-2-fluoroethyl]carbamate
tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-1-(3-chlorophenyl)-2-fluoroethyl]carbamate (PubChem CID 16680548) has the molecular formula C25H25ClFNO6S2
and a molecular weight of 554.06 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-1-(3-chlorophenyl)-2-fluoroethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-1-(3-chlorophenyl)-2-fluoroethyl]carbamate |
| PubChem CID | 16680548 |
| Molecular Formula | C25H25ClFNO6S2 |
| Molecular Weight | 554.06 g/mol |
| Exact Mass | 553.08 |
| IUPAC Name | tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-1-(3-chlorophenyl)-2-fluoroethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](c1cccc(Cl)c1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H25ClFNO6S2/c1-24(2,3)34-23(29)28-22(18-11-10-12-19(26)17-18)25(27,35(30,31)20-13-6-4-7-14-20)36(32,33)21-15-8-5-9-16-21/h4-17,22H,1-3H3,(H,28,29)/t22-/m0/s1 |
| InChIKey | JSCZBLPSGUJMDO-QFIPXVFZSA-N |
| XLogP | 5.48 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 554.06 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-1-(3-chlorophenyl)-2-fluoroethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-1-(3-chlorophenyl)-2-fluoroethyl]carbamate?
The IUPAC name of tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-1-(3-chlorophenyl)-2-fluoroethyl]carbamate (CID 16680548) is tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-1-(3-chlorophenyl)-2-fluoroethyl]carbamate.
What is the SMILES notation for tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-1-(3-chlorophenyl)-2-fluoroethyl]carbamate?
The canonical SMILES for tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-1-(3-chlorophenyl)-2-fluoroethyl]carbamate is CC(C)(C)OC(=O)N[C@@H](c1cccc(Cl)c1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1.
What is the InChIKey of tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-1-(3-chlorophenyl)-2-fluoroethyl]carbamate?
The InChIKey is JSCZBLPSGUJMDO-QFIPXVFZSA-N. The full InChI is InChI=1S/C25H25ClFNO6S2/c1-24(2,3)34-23(29)28-22(18-11-10-12-19(26)17-18)25(27,35(30,31)20-13-6-4-7-14-20)36(32,33)21-15-8-5-9-16-21/h4-17,22H,1-3H3,(H,28,29)/t22-/m0/s1.
What are the key properties of tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-1-(3-chlorophenyl)-2-fluoroethyl]carbamate?
tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-1-(3-chlorophenyl)-2-fluoroethyl]carbamate has a molecular weight of 554.06 g/mol, XLogP of 5.48, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-1-(3-chlorophenyl)-2-fluoroethyl]carbamate is sourced from PubChem (CID 16680548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).