C12H18O3 — CID 16680551
1-[(3aR,6aS)-4-(methoxymethoxy)-2,3,6,6a-tetrahydro-1H-pentalen-3a-yl]ethanone (PubChem CID 16680551) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 1-[(3aR,6aS)-4-(methoxymethoxy)-2,3,6,6a-tetrahydro-1H-pentalen-3a-yl]ethanone.
| Compound Name | 1-[(3aR,6aS)-4-(methoxymethoxy)-2,3,6,6a-tetrahydro-1H-pentalen-3a-yl]ethanone |
|---|---|
| PubChem CID | 16680551 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 1-[(3aR,6aS)-4-(methoxymethoxy)-2,3,6,6a-tetrahydro-1H-pentalen-3a-yl]ethanone |
| SMILES | COCOC1=CC[C@@H]2CCC[C@]12C(C)=O |
| InChI | InChI=1S/C12H18O3/c1-9(13)12-7-3-4-10(12)5-6-11(12)15-8-14-2/h6,10H,3-5,7-8H2,1-2H3/t10-,12+/m0/s1 |
| InChIKey | GSRPYJCNWOWFJG-CMPLNLGQSA-N |
| XLogP | 2.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|