C26H24N2 — CID 166805679
2,6-bis(3,5-dimethylphenyl)-3,7-dihydropyrrolo[2,3-f]indole (PubChem CID 166805679) has the molecular formula C26H24N2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 2,6-bis(3,5-dimethylphenyl)-3,7-dihydropyrrolo[2,3-f]indole.
| Compound Name | 2,6-bis(3,5-dimethylphenyl)-3,7-dihydropyrrolo[2,3-f]indole |
|---|---|
| PubChem CID | 166805679 |
| Molecular Formula | C26H24N2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 2,6-bis(3,5-dimethylphenyl)-3,7-dihydropyrrolo[2,3-f]indole |
| SMILES | Cc1cc(C)cc(C2=Nc3cc4c(cc3C2)N=C(c2cc(C)cc(C)c2)C4)c1 |
| InChI | InChI=1S/C26H24N2/c1-15-5-16(2)8-19(7-15)23-11-21-13-26-22(14-25(21)27-23)12-24(28-26)20-9-17(3)6-18(4)10-20/h5-10,13-14H,11-12H2,1-4H3 |
| InChIKey | NVZTWSNXWCVXSC-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |