C32H28N2 — CID 166805755
2,6-bis[(1E)-1-(2-methylphenyl)buta-1,3-dienyl]-3,7-dihydropyrrolo[2,3-f]indole (PubChem CID 166805755) has the molecular formula C32H28N2 and a molecular weight of 440.59 g/mol. Its IUPAC name is 2,6-bis[(1E)-1-(2-methylphenyl)buta-1,3-dienyl]-3,7-dihydropyrrolo[2,3-f]indole.
| Compound Name | 2,6-bis[(1E)-1-(2-methylphenyl)buta-1,3-dienyl]-3,7-dihydropyrrolo[2,3-f]indole |
|---|---|
| PubChem CID | 166805755 |
| Molecular Formula | C32H28N2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 2,6-bis[(1E)-1-(2-methylphenyl)buta-1,3-dienyl]-3,7-dihydropyrrolo[2,3-f]indole |
| SMILES | C=C/C=C(/C1=Nc2cc3c(cc2C1)N=C(/C(=C/C=C)c1ccccc1C)C3)c1ccccc1C |
| InChI | InChI=1S/C32H28N2/c1-5-11-27(25-15-9-7-13-21(25)3)31-19-23-17-30-24(18-29(23)33-31)20-32(34-30)28(12-6-2)26-16-10-8-14-22(26)4/h5-18H,1-2,19-20H2,3-4H3/b27-11+,28-12+ |
| InChIKey | INDIAVKSWFIRJS-NXMZODBASA-N |
| XLogP | 8.10 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|