C60H40F3N5O3S — CID 166806191
[2-[2-[3,5-bis[2-(2-methylimidazo[2,1-a]isoquinolin-8-yl)phenyl]phenyl]phenyl]-5-pyridin-2-ylphenyl] trifluoromethanesulfonate (PubChem CID 166806191) has the molecular formula C60H40F3N5O3S and a molecular weight of 968.07 g/mol. Its IUPAC name is [2-[2-[3,5-bis[2-(2-methylimidazo[2,1-a]isoquinolin-8-yl)phenyl]phenyl]phenyl]-5-pyridin-2-ylphenyl] trifluoromethanesulfonate.
| Compound Name | [2-[2-[3,5-bis[2-(2-methylimidazo[2,1-a]isoquinolin-8-yl)phenyl]phenyl]phenyl]-5-pyridin-2-ylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 166806191 |
| Molecular Formula | C60H40F3N5O3S |
| Molecular Weight | 968.07 g/mol |
| Exact Mass | 967.28 |
| IUPAC Name | [2-[2-[3,5-bis[2-(2-methylimidazo[2,1-a]isoquinolin-8-yl)phenyl]phenyl]phenyl]-5-pyridin-2-ylphenyl] trifluoromethanesulfonate |
| SMILES | Cc1cn2ccc3cc(-c4ccccc4-c4cc(-c5ccccc5-c5ccc6c(ccn7cc(C)nc67)c5)cc(-c5ccccc5-c5ccc(-c6ccccn6)cc5OS(=O)(=O)C(F)(F)F)c4)ccc3c2n1 |
| InChI | InChI=1S/C60H40F3N5O3S/c1-37-35-67-27-24-41-29-39(18-21-52(41)58(67)65-37)47-11-3-5-13-49(47)44-31-45(50-14-6-4-12-48(50)40-19-22-53-42(30-40)25-28-68-36-38(2)66-59(53)68)33-46(32-44)51-15-7-8-16-54(51)55-23-20-43(56-17-9-10-26-64-56)34-57(55)71-72(69,70)60(61,62)63/h3-36H,1-2H3 |
| InChIKey | GZJXPDMXSWOXHO-UHFFFAOYSA-N |
| XLogP | 15.20 |
| TPSA | 90.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 968.07 |
| LogP ≤ 5 | 15.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|