C10H10F2O2 — CID 166806450
4-ethenyl-2,2-difluoro-5-[(2Z)-penta-2,4-dien-2-yl]-1,3-dioxole (PubChem CID 166806450) has the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. Its IUPAC name is 4-ethenyl-2,2-difluoro-5-[(2Z)-penta-2,4-dien-2-yl]-1,3-dioxole.
| Compound Name | 4-ethenyl-2,2-difluoro-5-[(2Z)-penta-2,4-dien-2-yl]-1,3-dioxole |
|---|---|
| PubChem CID | 166806450 |
| Molecular Formula | C10H10F2O2 |
| Molecular Weight | 200.18 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 4-ethenyl-2,2-difluoro-5-[(2Z)-penta-2,4-dien-2-yl]-1,3-dioxole |
| SMILES | C=C/C=C(/C)C1=C(C=C)OC(F)(F)O1 |
| InChI | InChI=1S/C10H10F2O2/c1-4-6-7(3)9-8(5-2)13-10(11,12)14-9/h4-6H,1-2H2,3H3/b7-6- |
| InChIKey | NOCVKKRBZQWJDG-SREVYHEPSA-N |
| XLogP | 3.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.18 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|