About (4E)-8-methyl-4-(methylsulfanylmethyl)deca-1,4-dien-9-yne
(4E)-8-methyl-4-(methylsulfanylmethyl)deca-1,4-dien-9-yne (PubChem CID 166806536) has the molecular formula C13H20S
and a molecular weight of 208.37 g/mol. Its IUPAC name is (4E)-8-methyl-4-(methylsulfanylmethyl)deca-1,4-dien-9-yne.
Molecular Properties
| Compound Name | (4E)-8-methyl-4-(methylsulfanylmethyl)deca-1,4-dien-9-yne |
| PubChem CID | 166806536 |
| Molecular Formula | C13H20S |
| Molecular Weight | 208.37 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | (4E)-8-methyl-4-(methylsulfanylmethyl)deca-1,4-dien-9-yne |
| SMILES | C#CC(C)CC/C=C(\CC=C)CSC |
| InChI | InChI=1S/C13H20S/c1-5-8-13(11-14-4)10-7-9-12(3)6-2/h2,5,10,12H,1,7-9,11H2,3-4H3/b13-10+ |
| InChIKey | JVQNTBIIAAZILR-JLHYYAGUSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4E)-8-methyl-4-(methylsulfanylmethyl)deca-1,4-dien-9-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-8-methyl-4-(methylsulfanylmethyl)deca-1,4-dien-9-yne?
The IUPAC name of (4E)-8-methyl-4-(methylsulfanylmethyl)deca-1,4-dien-9-yne (CID 166806536) is (4E)-8-methyl-4-(methylsulfanylmethyl)deca-1,4-dien-9-yne.
What is the SMILES notation for (4E)-8-methyl-4-(methylsulfanylmethyl)deca-1,4-dien-9-yne?
The canonical SMILES for (4E)-8-methyl-4-(methylsulfanylmethyl)deca-1,4-dien-9-yne is C#CC(C)CC/C=C(\CC=C)CSC.
What is the InChIKey of (4E)-8-methyl-4-(methylsulfanylmethyl)deca-1,4-dien-9-yne?
The InChIKey is JVQNTBIIAAZILR-JLHYYAGUSA-N. The full InChI is InChI=1S/C13H20S/c1-5-8-13(11-14-4)10-7-9-12(3)6-2/h2,5,10,12H,1,7-9,11H2,3-4H3/b13-10+.
What are the key properties of (4E)-8-methyl-4-(methylsulfanylmethyl)deca-1,4-dien-9-yne?
(4E)-8-methyl-4-(methylsulfanylmethyl)deca-1,4-dien-9-yne has a molecular weight of 208.37 g/mol, XLogP of 3.90, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-8-methyl-4-(methylsulfanylmethyl)deca-1,4-dien-9-yne is sourced from PubChem (CID 166806536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).