About 2,4,6-trihydroxy-3,5-diiodobenzonitrile
2,4,6-trihydroxy-3,5-diiodobenzonitrile (PubChem CID 166806871) has the molecular formula C7H3I2NO3
and a molecular weight of 402.91 g/mol. Its IUPAC name is 2,4,6-trihydroxy-3,5-diiodobenzonitrile.
Molecular Properties
| Compound Name | 2,4,6-trihydroxy-3,5-diiodobenzonitrile |
| PubChem CID | 166806871 |
| Molecular Formula | C7H3I2NO3 |
| Molecular Weight | 402.91 g/mol |
| Exact Mass | 402.82 |
| IUPAC Name | 2,4,6-trihydroxy-3,5-diiodobenzonitrile |
| SMILES | N#Cc1c(O)c(I)c(O)c(I)c1O |
| InChI | InChI=1S/C7H3I2NO3/c8-3-5(11)2(1-10)6(12)4(9)7(3)13/h11-13H |
| InChIKey | LBZLJOOHUKOQPI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.91 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,4,6-trihydroxy-3,5-diiodobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,6-trihydroxy-3,5-diiodobenzonitrile?
The IUPAC name of 2,4,6-trihydroxy-3,5-diiodobenzonitrile (CID 166806871) is 2,4,6-trihydroxy-3,5-diiodobenzonitrile.
What is the SMILES notation for 2,4,6-trihydroxy-3,5-diiodobenzonitrile?
The canonical SMILES for 2,4,6-trihydroxy-3,5-diiodobenzonitrile is N#Cc1c(O)c(I)c(O)c(I)c1O.
What is the InChIKey of 2,4,6-trihydroxy-3,5-diiodobenzonitrile?
The InChIKey is LBZLJOOHUKOQPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3I2NO3/c8-3-5(11)2(1-10)6(12)4(9)7(3)13/h11-13H.
What are the key properties of 2,4,6-trihydroxy-3,5-diiodobenzonitrile?
2,4,6-trihydroxy-3,5-diiodobenzonitrile has a molecular weight of 402.91 g/mol, XLogP of 1.88, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6-trihydroxy-3,5-diiodobenzonitrile is sourced from PubChem (CID 166806871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).