About 7-N-benzylisoquinoline-1,7-diamine;dihydrochloride
7-N-benzylisoquinoline-1,7-diamine;dihydrochloride (PubChem CID 16680695) has the molecular formula C16H17Cl2N3
and a molecular weight of 322.24 g/mol. Its IUPAC name is 7-N-benzylisoquinoline-1,7-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 7-N-benzylisoquinoline-1,7-diamine;dihydrochloride |
| PubChem CID | 16680695 |
| Molecular Formula | C16H17Cl2N3 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 7-N-benzylisoquinoline-1,7-diamine;dihydrochloride |
| SMILES | Cl.Cl.Nc1nccc2ccc(NCc3ccccc3)cc12 |
| InChI | InChI=1S/C16H15N3.2ClH/c17-16-15-10-14(7-6-13(15)8-9-18-16)19-11-12-4-2-1-3-5-12;;/h1-10,19H,11H2,(H2,17,18);2*1H |
| InChIKey | UZWKFZAWTYESKQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-N-benzylisoquinoline-1,7-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-N-benzylisoquinoline-1,7-diamine;dihydrochloride?
The IUPAC name of 7-N-benzylisoquinoline-1,7-diamine;dihydrochloride (CID 16680695) is 7-N-benzylisoquinoline-1,7-diamine;dihydrochloride.
What is the SMILES notation for 7-N-benzylisoquinoline-1,7-diamine;dihydrochloride?
The canonical SMILES for 7-N-benzylisoquinoline-1,7-diamine;dihydrochloride is Cl.Cl.Nc1nccc2ccc(NCc3ccccc3)cc12.
What is the InChIKey of 7-N-benzylisoquinoline-1,7-diamine;dihydrochloride?
The InChIKey is UZWKFZAWTYESKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3.2ClH/c17-16-15-10-14(7-6-13(15)8-9-18-16)19-11-12-4-2-1-3-5-12;;/h1-10,19H,11H2,(H2,17,18);2*1H.
What are the key properties of 7-N-benzylisoquinoline-1,7-diamine;dihydrochloride?
7-N-benzylisoquinoline-1,7-diamine;dihydrochloride has a molecular weight of 322.24 g/mol, XLogP of 4.27, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-N-benzylisoquinoline-1,7-diamine;dihydrochloride is sourced from PubChem (CID 16680695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).