About 7-N-[(3-bromophenyl)methyl]isoquinoline-1,7-diamine
7-N-[(3-bromophenyl)methyl]isoquinoline-1,7-diamine (PubChem CID 16680702) has the molecular formula C16H14BrN3
and a molecular weight of 328.21 g/mol. Its IUPAC name is 7-N-[(3-bromophenyl)methyl]isoquinoline-1,7-diamine.
Molecular Properties
| Compound Name | 7-N-[(3-bromophenyl)methyl]isoquinoline-1,7-diamine |
| PubChem CID | 16680702 |
| Molecular Formula | C16H14BrN3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 7-N-[(3-bromophenyl)methyl]isoquinoline-1,7-diamine |
| SMILES | Nc1nccc2ccc(NCc3cccc(Br)c3)cc12 |
| InChI | InChI=1S/C16H14BrN3/c17-13-3-1-2-11(8-13)10-20-14-5-4-12-6-7-19-16(18)15(12)9-14/h1-9,20H,10H2,(H2,18,19) |
| InChIKey | PLGCSVDCLCLBIF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-N-[(3-bromophenyl)methyl]isoquinoline-1,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-N-[(3-bromophenyl)methyl]isoquinoline-1,7-diamine?
The IUPAC name of 7-N-[(3-bromophenyl)methyl]isoquinoline-1,7-diamine (CID 16680702) is 7-N-[(3-bromophenyl)methyl]isoquinoline-1,7-diamine.
What is the SMILES notation for 7-N-[(3-bromophenyl)methyl]isoquinoline-1,7-diamine?
The canonical SMILES for 7-N-[(3-bromophenyl)methyl]isoquinoline-1,7-diamine is Nc1nccc2ccc(NCc3cccc(Br)c3)cc12.
What is the InChIKey of 7-N-[(3-bromophenyl)methyl]isoquinoline-1,7-diamine?
The InChIKey is PLGCSVDCLCLBIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14BrN3/c17-13-3-1-2-11(8-13)10-20-14-5-4-12-6-7-19-16(18)15(12)9-14/h1-9,20H,10H2,(H2,18,19).
What are the key properties of 7-N-[(3-bromophenyl)methyl]isoquinoline-1,7-diamine?
7-N-[(3-bromophenyl)methyl]isoquinoline-1,7-diamine has a molecular weight of 328.21 g/mol, XLogP of 4.19, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-N-[(3-bromophenyl)methyl]isoquinoline-1,7-diamine is sourced from PubChem (CID 16680702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).