C10H14N2 — CID 166807036
6,9-dimethyl-4,8-dihydro-3H-pyrido[1,2-a]pyrazine (PubChem CID 166807036) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 6,9-dimethyl-4,8-dihydro-3H-pyrido[1,2-a]pyrazine.
| Compound Name | 6,9-dimethyl-4,8-dihydro-3H-pyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 166807036 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 6,9-dimethyl-4,8-dihydro-3H-pyrido[1,2-a]pyrazine |
| SMILES | CC1=CCC(C)=C2C=NCCN12 |
| InChI | InChI=1S/C10H14N2/c1-8-3-4-9(2)12-6-5-11-7-10(8)12/h4,7H,3,5-6H2,1-2H3 |
| InChIKey | WLWHRLCASJAFIA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |