About 3-ethanimidoyl-2-N,4-N-dimethylpyridine-2,4-diamine
3-ethanimidoyl-2-N,4-N-dimethylpyridine-2,4-diamine (PubChem CID 166807042) has the molecular formula C9H14N4
and a molecular weight of 178.24 g/mol. Its IUPAC name is 3-ethanimidoyl-2-N,4-N-dimethylpyridine-2,4-diamine.
Molecular Properties
| Compound Name | 3-ethanimidoyl-2-N,4-N-dimethylpyridine-2,4-diamine |
| PubChem CID | 166807042 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 3-ethanimidoyl-2-N,4-N-dimethylpyridine-2,4-diamine |
| SMILES | [H]/N=C(\C)c1c(NC)ccnc1NC |
| InChI | InChI=1S/C9H14N4/c1-6(10)8-7(11-2)4-5-13-9(8)12-3/h4-5,10H,1-3H3,(H2,11,12,13)/b10-6+ |
| InChIKey | OALCWHNHQPMNIB-UXBLZVDNSA-N |
| XLogP | 1.55 |
| TPSA | 60.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-ethanimidoyl-2-N,4-N-dimethylpyridine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethanimidoyl-2-N,4-N-dimethylpyridine-2,4-diamine?
The IUPAC name of 3-ethanimidoyl-2-N,4-N-dimethylpyridine-2,4-diamine (CID 166807042) is 3-ethanimidoyl-2-N,4-N-dimethylpyridine-2,4-diamine.
What is the SMILES notation for 3-ethanimidoyl-2-N,4-N-dimethylpyridine-2,4-diamine?
The canonical SMILES for 3-ethanimidoyl-2-N,4-N-dimethylpyridine-2,4-diamine is [H]/N=C(\C)c1c(NC)ccnc1NC.
What is the InChIKey of 3-ethanimidoyl-2-N,4-N-dimethylpyridine-2,4-diamine?
The InChIKey is OALCWHNHQPMNIB-UXBLZVDNSA-N. The full InChI is InChI=1S/C9H14N4/c1-6(10)8-7(11-2)4-5-13-9(8)12-3/h4-5,10H,1-3H3,(H2,11,12,13)/b10-6+.
What are the key properties of 3-ethanimidoyl-2-N,4-N-dimethylpyridine-2,4-diamine?
3-ethanimidoyl-2-N,4-N-dimethylpyridine-2,4-diamine has a molecular weight of 178.24 g/mol, XLogP of 1.55, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethanimidoyl-2-N,4-N-dimethylpyridine-2,4-diamine is sourced from PubChem (CID 166807042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).