C13H15N3 — CID 16680726
5,6,7,8-tetrahydroacridine-2,9-diamine (PubChem CID 16680726) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 5,6,7,8-tetrahydroacridine-2,9-diamine.
| Compound Name | 5,6,7,8-tetrahydroacridine-2,9-diamine |
|---|---|
| PubChem CID | 16680726 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 5,6,7,8-tetrahydroacridine-2,9-diamine |
| SMILES | Nc1ccc2nc3c(c(N)c2c1)CCCC3 |
| InChI | InChI=1S/C13H15N3/c14-8-5-6-12-10(7-8)13(15)9-3-1-2-4-11(9)16-12/h5-7H,1-4,14H2,(H2,15,16) |
| InChIKey | QJJKZOSVUGJCLY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|