About 3-benzoyl-2-sulfanylidene-1H-pyrido[2,1-f][1,2,4]triazin-9-ium-4-one
3-benzoyl-2-sulfanylidene-1H-pyrido[2,1-f][1,2,4]triazin-9-ium-4-one (PubChem CID 16680752) has the molecular formula C14H10N3O2S+
and a molecular weight of 284.32 g/mol. Its IUPAC name is 3-benzoyl-2-sulfanylidene-1H-pyrido[2,1-f][1,2,4]triazin-9-ium-4-one.
Molecular Properties
| Compound Name | 3-benzoyl-2-sulfanylidene-1H-pyrido[2,1-f][1,2,4]triazin-9-ium-4-one |
| PubChem CID | 16680752 |
| Molecular Formula | C14H10N3O2S+ |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 3-benzoyl-2-sulfanylidene-1H-pyrido[2,1-f][1,2,4]triazin-9-ium-4-one |
| SMILES | O=C(c1ccccc1)n1c(=S)[nH][n+]2ccccc2c1=O |
| InChI | InChI=1S/C14H9N3O2S/c18-12(10-6-2-1-3-7-10)17-13(19)11-8-4-5-9-16(11)15-14(17)20/h1-9H/p+1 |
| InChIKey | RFAMWNKCWPEQNH-UHFFFAOYSA-O |
| XLogP | 1.33 |
| TPSA | 58.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-benzoyl-2-sulfanylidene-1H-pyrido[2,1-f][1,2,4]triazin-9-ium-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzoyl-2-sulfanylidene-1H-pyrido[2,1-f][1,2,4]triazin-9-ium-4-one?
The IUPAC name of 3-benzoyl-2-sulfanylidene-1H-pyrido[2,1-f][1,2,4]triazin-9-ium-4-one (CID 16680752) is 3-benzoyl-2-sulfanylidene-1H-pyrido[2,1-f][1,2,4]triazin-9-ium-4-one.
What is the SMILES notation for 3-benzoyl-2-sulfanylidene-1H-pyrido[2,1-f][1,2,4]triazin-9-ium-4-one?
The canonical SMILES for 3-benzoyl-2-sulfanylidene-1H-pyrido[2,1-f][1,2,4]triazin-9-ium-4-one is O=C(c1ccccc1)n1c(=S)[nH][n+]2ccccc2c1=O.
What is the InChIKey of 3-benzoyl-2-sulfanylidene-1H-pyrido[2,1-f][1,2,4]triazin-9-ium-4-one?
The InChIKey is RFAMWNKCWPEQNH-UHFFFAOYSA-O. The full InChI is InChI=1S/C14H9N3O2S/c18-12(10-6-2-1-3-7-10)17-13(19)11-8-4-5-9-16(11)15-14(17)20/h1-9H/p+1.
What are the key properties of 3-benzoyl-2-sulfanylidene-1H-pyrido[2,1-f][1,2,4]triazin-9-ium-4-one?
3-benzoyl-2-sulfanylidene-1H-pyrido[2,1-f][1,2,4]triazin-9-ium-4-one has a molecular weight of 284.32 g/mol, XLogP of 1.33, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzoyl-2-sulfanylidene-1H-pyrido[2,1-f][1,2,4]triazin-9-ium-4-one is sourced from PubChem (CID 16680752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).