C11H13ClFN — CID 166807621
(5Z,7E)-2-chloro-7-fluoro-N-methyl-4-methylidenenona-1,5,7-trien-3-imine (PubChem CID 166807621) has the molecular formula C11H13ClFN and a molecular weight of 213.68 g/mol. Its IUPAC name is (5Z,7E)-2-chloro-7-fluoro-N-methyl-4-methylidenenona-1,5,7-trien-3-imine.
| Compound Name | (5Z,7E)-2-chloro-7-fluoro-N-methyl-4-methylidenenona-1,5,7-trien-3-imine |
|---|---|
| PubChem CID | 166807621 |
| Molecular Formula | C11H13ClFN |
| Molecular Weight | 213.68 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | (5Z,7E)-2-chloro-7-fluoro-N-methyl-4-methylidenenona-1,5,7-trien-3-imine |
| SMILES | C=C(Cl)/C(=N\C)C(=C)/C=C\C(F)=C/C |
| InChI | InChI=1S/C11H13ClFN/c1-5-10(13)7-6-8(2)11(14-4)9(3)12/h5-7H,2-3H2,1,4H3/b7-6-,10-5+,14-11- |
| InChIKey | JISXVLGQWOYDEX-FRCVESHYSA-N |
| XLogP | 3.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.68 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|