C33H50N4S — CID 166807881
N-[4,4-dimethyl-2-[2-[1-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methylamino]ethenyl]pyrrolidin-1-yl]pent-1-en-3-yl]non-8-en-1-amine (PubChem CID 166807881) has the molecular formula C33H50N4S and a molecular weight of 534.86 g/mol. Its IUPAC name is N-[4,4-dimethyl-2-[2-[1-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methylamino]ethenyl]pyrrolidin-1-yl]pent-1-en-3-yl]non-8-en-1-amine.
| Compound Name | N-[4,4-dimethyl-2-[2-[1-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methylamino]ethenyl]pyrrolidin-1-yl]pent-1-en-3-yl]non-8-en-1-amine |
|---|---|
| PubChem CID | 166807881 |
| Molecular Formula | C33H50N4S |
| Molecular Weight | 534.86 g/mol |
| Exact Mass | 534.38 |
| IUPAC Name | N-[4,4-dimethyl-2-[2-[1-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methylamino]ethenyl]pyrrolidin-1-yl]pent-1-en-3-yl]non-8-en-1-amine |
| SMILES | C=CCCCCCCCNC(C(=C)N1CCCC1C(=C)NCc1ccc(-c2scnc2C)cc1)C(C)(C)C |
| InChI | InChI=1S/C33H50N4S/c1-8-9-10-11-12-13-14-21-34-32(33(5,6)7)27(4)37-22-15-16-30(37)25(2)35-23-28-17-19-29(20-18-28)31-26(3)36-24-38-31/h8,17-20,24,30,32,34-35H,1-2,4,9-16,21-23H2,3,5-7H3 |
| InChIKey | BIPVYMBSQIZQCK-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.86 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|