About 3-chloro-2-[(2S,4R)-2-chloropiperidin-4-yl]oxypyridine
3-chloro-2-[(2S,4R)-2-chloropiperidin-4-yl]oxypyridine (PubChem CID 166808122) has the molecular formula C10H12Cl2N2O
and a molecular weight of 247.12 g/mol. Its IUPAC name is 3-chloro-2-[(2S,4R)-2-chloropiperidin-4-yl]oxypyridine.
Molecular Properties
| Compound Name | 3-chloro-2-[(2S,4R)-2-chloropiperidin-4-yl]oxypyridine |
| PubChem CID | 166808122 |
| Molecular Formula | C10H12Cl2N2O |
| Molecular Weight | 247.12 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 3-chloro-2-[(2S,4R)-2-chloropiperidin-4-yl]oxypyridine |
| SMILES | Clc1cccnc1O[C@@H]1CCN[C@@H](Cl)C1 |
| InChI | InChI=1S/C10H12Cl2N2O/c11-8-2-1-4-14-10(8)15-7-3-5-13-9(12)6-7/h1-2,4,7,9,13H,3,5-6H2/t7-,9-/m1/s1 |
| InChIKey | OLJXMXZFTPFKGC-VXNVDRBHSA-N |
| XLogP | 2.43 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.12 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2-[(2S,4R)-2-chloropiperidin-4-yl]oxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-[(2S,4R)-2-chloropiperidin-4-yl]oxypyridine?
The IUPAC name of 3-chloro-2-[(2S,4R)-2-chloropiperidin-4-yl]oxypyridine (CID 166808122) is 3-chloro-2-[(2S,4R)-2-chloropiperidin-4-yl]oxypyridine.
What is the SMILES notation for 3-chloro-2-[(2S,4R)-2-chloropiperidin-4-yl]oxypyridine?
The canonical SMILES for 3-chloro-2-[(2S,4R)-2-chloropiperidin-4-yl]oxypyridine is Clc1cccnc1O[C@@H]1CCN[C@@H](Cl)C1.
What is the InChIKey of 3-chloro-2-[(2S,4R)-2-chloropiperidin-4-yl]oxypyridine?
The InChIKey is OLJXMXZFTPFKGC-VXNVDRBHSA-N. The full InChI is InChI=1S/C10H12Cl2N2O/c11-8-2-1-4-14-10(8)15-7-3-5-13-9(12)6-7/h1-2,4,7,9,13H,3,5-6H2/t7-,9-/m1/s1.
What are the key properties of 3-chloro-2-[(2S,4R)-2-chloropiperidin-4-yl]oxypyridine?
3-chloro-2-[(2S,4R)-2-chloropiperidin-4-yl]oxypyridine has a molecular weight of 247.12 g/mol, XLogP of 2.43, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-[(2S,4R)-2-chloropiperidin-4-yl]oxypyridine is sourced from PubChem (CID 166808122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).