About [3-[(3R,5R)-5-methylsulfonyl-1-phenylpiperidin-3-yl]sulfonylphenyl]methanamine
[3-[(3R,5R)-5-methylsulfonyl-1-phenylpiperidin-3-yl]sulfonylphenyl]methanamine (PubChem CID 166808761) has the molecular formula C19H24N2O4S2
and a molecular weight of 408.55 g/mol. Its IUPAC name is [3-[(3R,5R)-5-methylsulfonyl-1-phenylpiperidin-3-yl]sulfonylphenyl]methanamine.
Molecular Properties
| Compound Name | [3-[(3R,5R)-5-methylsulfonyl-1-phenylpiperidin-3-yl]sulfonylphenyl]methanamine |
| PubChem CID | 166808761 |
| Molecular Formula | C19H24N2O4S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | [3-[(3R,5R)-5-methylsulfonyl-1-phenylpiperidin-3-yl]sulfonylphenyl]methanamine |
| SMILES | CS(=O)(=O)[C@@H]1C[C@@H](S(=O)(=O)c2cccc(CN)c2)CN(c2ccccc2)C1 |
| InChI | InChI=1S/C19H24N2O4S2/c1-26(22,23)18-11-19(14-21(13-18)16-7-3-2-4-8-16)27(24,25)17-9-5-6-15(10-17)12-20/h2-10,18-19H,11-14,20H2,1H3/t18-,19-/m1/s1 |
| InChIKey | XETMOSHEGZAEHW-RTBURBONSA-N |
| XLogP | 1.61 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-[(3R,5R)-5-methylsulfonyl-1-phenylpiperidin-3-yl]sulfonylphenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(3R,5R)-5-methylsulfonyl-1-phenylpiperidin-3-yl]sulfonylphenyl]methanamine?
The IUPAC name of [3-[(3R,5R)-5-methylsulfonyl-1-phenylpiperidin-3-yl]sulfonylphenyl]methanamine (CID 166808761) is [3-[(3R,5R)-5-methylsulfonyl-1-phenylpiperidin-3-yl]sulfonylphenyl]methanamine.
What is the SMILES notation for [3-[(3R,5R)-5-methylsulfonyl-1-phenylpiperidin-3-yl]sulfonylphenyl]methanamine?
The canonical SMILES for [3-[(3R,5R)-5-methylsulfonyl-1-phenylpiperidin-3-yl]sulfonylphenyl]methanamine is CS(=O)(=O)[C@@H]1C[C@@H](S(=O)(=O)c2cccc(CN)c2)CN(c2ccccc2)C1.
What is the InChIKey of [3-[(3R,5R)-5-methylsulfonyl-1-phenylpiperidin-3-yl]sulfonylphenyl]methanamine?
The InChIKey is XETMOSHEGZAEHW-RTBURBONSA-N. The full InChI is InChI=1S/C19H24N2O4S2/c1-26(22,23)18-11-19(14-21(13-18)16-7-3-2-4-8-16)27(24,25)17-9-5-6-15(10-17)12-20/h2-10,18-19H,11-14,20H2,1H3/t18-,19-/m1/s1.
What are the key properties of [3-[(3R,5R)-5-methylsulfonyl-1-phenylpiperidin-3-yl]sulfonylphenyl]methanamine?
[3-[(3R,5R)-5-methylsulfonyl-1-phenylpiperidin-3-yl]sulfonylphenyl]methanamine has a molecular weight of 408.55 g/mol, XLogP of 1.61, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(3R,5R)-5-methylsulfonyl-1-phenylpiperidin-3-yl]sulfonylphenyl]methanamine is sourced from PubChem (CID 166808761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).