C20H33N3O2 — CID 166809508
[(4S,5S,6R)-12-butan-2-yl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methyl 2-methylpentanoate (PubChem CID 166809508) has the molecular formula C20H33N3O2 and a molecular weight of 347.50 g/mol. Its IUPAC name is [(4S,5S,6R)-12-butan-2-yl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methyl 2-methylpentanoate.
| Compound Name | [(4S,5S,6R)-12-butan-2-yl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methyl 2-methylpentanoate |
|---|---|
| PubChem CID | 166809508 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | [(4S,5S,6R)-12-butan-2-yl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methyl 2-methylpentanoate |
| SMILES | CCCC(C)C(=O)OC[C@@H]1[C@@H]2CCc3nnn(C(C)CC)c3CC[C@@H]21 |
| InChI | InChI=1S/C20H33N3O2/c1-5-7-13(3)20(24)25-12-17-15-8-10-18-19(11-9-16(15)17)23(22-21-18)14(4)6-2/h13-17H,5-12H2,1-4H3/t13?,14?,15-,16+,17-/m1/s1 |
| InChIKey | QJEPRSJIZACZCT-GADNRMJZSA-N |
| XLogP | 3.97 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |