C12H18FN — CID 166810403
(6E,8Z)-6-fluoro-2-methylundeca-1,6,8,10-tetraen-3-amine (PubChem CID 166810403) has the molecular formula C12H18FN and a molecular weight of 195.28 g/mol. Its IUPAC name is (6E,8Z)-6-fluoro-2-methylundeca-1,6,8,10-tetraen-3-amine.
| Compound Name | (6E,8Z)-6-fluoro-2-methylundeca-1,6,8,10-tetraen-3-amine |
|---|---|
| PubChem CID | 166810403 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | (6E,8Z)-6-fluoro-2-methylundeca-1,6,8,10-tetraen-3-amine |
| SMILES | C=C/C=C\C=C(\F)CCC(N)C(=C)C |
| InChI | InChI=1S/C12H18FN/c1-4-5-6-7-11(13)8-9-12(14)10(2)3/h4-7,12H,1-2,8-9,14H2,3H3/b6-5-,11-7+ |
| InChIKey | OQFKSGCJCBIQLI-GNLLZQBYSA-N |
| XLogP | 3.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|