C39H70N8O9 — CID 166810444
propan-2-yl N-[6-[3,5-bis[6-[1-(2-methylaziridin-1-yl)propan-2-yloxycarbonylamino]hexyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexyl]carbamate (PubChem CID 166810444) has the molecular formula C39H70N8O9 and a molecular weight of 795.04 g/mol. Its IUPAC name is propan-2-yl N-[6-[3,5-bis[6-[1-(2-methylaziridin-1-yl)propan-2-yloxycarbonylamino]hexyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexyl]carbamate.
| Compound Name | propan-2-yl N-[6-[3,5-bis[6-[1-(2-methylaziridin-1-yl)propan-2-yloxycarbonylamino]hexyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexyl]carbamate |
|---|---|
| PubChem CID | 166810444 |
| Molecular Formula | C39H70N8O9 |
| Molecular Weight | 795.04 g/mol |
| Exact Mass | 794.53 |
| IUPAC Name | propan-2-yl N-[6-[3,5-bis[6-[1-(2-methylaziridin-1-yl)propan-2-yloxycarbonylamino]hexyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexyl]carbamate |
| SMILES | CC(C)OC(=O)NCCCCCCn1c(=O)n(CCCCCCNC(=O)OC(C)CN2CC2C)c(=O)n(CCCCCCNC(=O)OC(C)CN2CC2C)c1=O |
| InChI | InChI=1S/C39H70N8O9/c1-29(2)54-34(48)40-19-13-7-10-16-22-45-37(51)46(23-17-11-8-14-20-41-35(49)55-32(5)27-43-25-30(43)3)39(53)47(38(45)52)24-18-12-9-15-21-42-36(50)56-33(6)28-44-26-31(44)4/h29-33H,7-28H2,1-6H3,(H,40,48)(H,41,49)(H,42,50) |
| InChIKey | GSODFKLUODVVSI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 187.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.04 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|