C26H34F3N7O2 — CID 166811016
2-[[[amino-(2-amino-5-tert-butyl-4-methylphenyl)methylidene]amino]methyl]-5-(difluoromethyl)-N-[(3S)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl]-3-methylimidazole-4-carboxamide (PubChem CID 166811016) has the molecular formula C26H34F3N7O2 and a molecular weight of 533.60 g/mol. Its IUPAC name is 2-[[[amino-(2-amino-5-tert-butyl-4-methylphenyl)methylidene]amino]methyl]-5-(difluoromethyl)-N-[(3S)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl]-3-methylimidazole-4-carboxamide.
| Compound Name | 2-[[[amino-(2-amino-5-tert-butyl-4-methylphenyl)methylidene]amino]methyl]-5-(difluoromethyl)-N-[(3S)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl]-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 166811016 |
| Molecular Formula | C26H34F3N7O2 |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | 2-[[[amino-(2-amino-5-tert-butyl-4-methylphenyl)methylidene]amino]methyl]-5-(difluoromethyl)-N-[(3S)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl]-3-methylimidazole-4-carboxamide |
| SMILES | C=CC(=O)N1CC(F)[C@@H](NC(=O)c2c(C(F)F)nc(C/N=C(\N)c3cc(C(C)(C)C)c(C)cc3N)n2C)C1 |
| InChI | InChI=1S/C26H34F3N7O2/c1-7-20(37)36-11-16(27)18(12-36)33-25(38)22-21(23(28)29)34-19(35(22)6)10-32-24(31)14-9-15(26(3,4)5)13(2)8-17(14)30/h7-9,16,18,23H,1,10-12,30H2,2-6H3,(H2,31,32)(H,33,38)/t16?,18-/m0/s1 |
| InChIKey | QSGAQGWMAHAHHP-DAFXYXGESA-N |
| XLogP | 2.92 |
| TPSA | 131.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|