C27H47NO4 — CID 166811081
4-[3-[2-amino-2-[2-(6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl)ethoxy]propoxy]-2,3-dimethylbutoxy]-2,4-dimethylpent-1-en-3-one (PubChem CID 166811081) has the molecular formula C27H47NO4 and a molecular weight of 449.68 g/mol. Its IUPAC name is 4-[3-[2-amino-2-[2-(6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl)ethoxy]propoxy]-2,3-dimethylbutoxy]-2,4-dimethylpent-1-en-3-one.
| Compound Name | 4-[3-[2-amino-2-[2-(6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl)ethoxy]propoxy]-2,3-dimethylbutoxy]-2,4-dimethylpent-1-en-3-one |
|---|---|
| PubChem CID | 166811081 |
| Molecular Formula | C27H47NO4 |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 449.35 |
| IUPAC Name | 4-[3-[2-amino-2-[2-(6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl)ethoxy]propoxy]-2,3-dimethylbutoxy]-2,4-dimethylpent-1-en-3-one |
| SMILES | C=C(C)C(=O)C(C)(C)OCC(C)C(C)(C)OCC(C)(N)OCCC1=CC2CC(C1)C2(C)C |
| InChI | InChI=1S/C27H47NO4/c1-18(2)23(29)26(8,9)31-16-19(3)25(6,7)32-17-27(10,28)30-12-11-20-13-21-15-22(14-20)24(21,4)5/h13,19,21-22H,1,11-12,14-17,28H2,2-10H3 |
| InChIKey | SQCQKNSYSJQYKP-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|