About 2-tert-butyl-4-fluoro-5-methylcyclohexa-1,3-dien-1-ol
2-tert-butyl-4-fluoro-5-methylcyclohexa-1,3-dien-1-ol (PubChem CID 166811241) has the molecular formula C11H17FO
and a molecular weight of 184.25 g/mol. Its IUPAC name is 2-tert-butyl-4-fluoro-5-methylcyclohexa-1,3-dien-1-ol.
Molecular Properties
| Compound Name | 2-tert-butyl-4-fluoro-5-methylcyclohexa-1,3-dien-1-ol |
| PubChem CID | 166811241 |
| Molecular Formula | C11H17FO |
| Molecular Weight | 184.25 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 2-tert-butyl-4-fluoro-5-methylcyclohexa-1,3-dien-1-ol |
| SMILES | CC1CC(O)=C(C(C)(C)C)C=C1F |
| InChI | InChI=1S/C11H17FO/c1-7-5-10(13)8(6-9(7)12)11(2,3)4/h6-7,13H,5H2,1-4H3 |
| InChIKey | SQBNICWKGUYHFL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.25 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-tert-butyl-4-fluoro-5-methylcyclohexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4-fluoro-5-methylcyclohexa-1,3-dien-1-ol?
The IUPAC name of 2-tert-butyl-4-fluoro-5-methylcyclohexa-1,3-dien-1-ol (CID 166811241) is 2-tert-butyl-4-fluoro-5-methylcyclohexa-1,3-dien-1-ol.
What is the SMILES notation for 2-tert-butyl-4-fluoro-5-methylcyclohexa-1,3-dien-1-ol?
The canonical SMILES for 2-tert-butyl-4-fluoro-5-methylcyclohexa-1,3-dien-1-ol is CC1CC(O)=C(C(C)(C)C)C=C1F.
What is the InChIKey of 2-tert-butyl-4-fluoro-5-methylcyclohexa-1,3-dien-1-ol?
The InChIKey is SQBNICWKGUYHFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17FO/c1-7-5-10(13)8(6-9(7)12)11(2,3)4/h6-7,13H,5H2,1-4H3.
What are the key properties of 2-tert-butyl-4-fluoro-5-methylcyclohexa-1,3-dien-1-ol?
2-tert-butyl-4-fluoro-5-methylcyclohexa-1,3-dien-1-ol has a molecular weight of 184.25 g/mol, XLogP of 3.74, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4-fluoro-5-methylcyclohexa-1,3-dien-1-ol is sourced from PubChem (CID 166811241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).