C34H31NO8 — CID 166811473
14-acetyl-10-(cyclopentylamino)-9,17-dihydroxy-5,16,21-trimethoxy-13-methylhexacyclo[13.8.0.02,11.03,8.04,22.018,23]tricosa-1(15),2(11),3(8),4(22),5,9,12,16,18(23),20-decaene-7,19-dione (PubChem CID 166811473) has the molecular formula C34H31NO8 and a molecular weight of 581.62 g/mol. Its IUPAC name is 14-acetyl-10-(cyclopentylamino)-9,17-dihydroxy-5,16,21-trimethoxy-13-methylhexacyclo[13.8.0.02,11.03,8.04,22.018,23]tricosa-1(15),2(11),3(8),4(22),5,9,12,16,18(23),20-decaene-7,19-dione.
| Compound Name | 14-acetyl-10-(cyclopentylamino)-9,17-dihydroxy-5,16,21-trimethoxy-13-methylhexacyclo[13.8.0.02,11.03,8.04,22.018,23]tricosa-1(15),2(11),3(8),4(22),5,9,12,16,18(23),20-decaene-7,19-dione |
|---|---|
| PubChem CID | 166811473 |
| Molecular Formula | C34H31NO8 |
| Molecular Weight | 581.62 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | 14-acetyl-10-(cyclopentylamino)-9,17-dihydroxy-5,16,21-trimethoxy-13-methylhexacyclo[13.8.0.02,11.03,8.04,22.018,23]tricosa-1(15),2(11),3(8),4(22),5,9,12,16,18(23),20-decaene-7,19-dione |
| SMILES | COc1c(O)c2c(=O)cc(OC)c3c4c(OC)cc(=O)c5c(O)c(NC6CCCC6)c6c(c(c1C(C(C)=O)C(C)=C6)c23)c54 |
| InChI | InChI=1S/C34H31NO8/c1-13-10-16-22-27-23(32(39)31(16)35-15-8-6-7-9-15)17(37)11-19(41-3)25(27)26-20(42-4)12-18(38)24-29(26)28(22)30(21(13)14(2)36)34(43-5)33(24)40/h10-12,15,21,35,39-40H,6-9H2,1-5H3 |
| InChIKey | SJWYQKQVHUQODJ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.62 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|