About propan-2-yl 3-methyl-2-oxohex-5-enoate
propan-2-yl 3-methyl-2-oxohex-5-enoate (PubChem CID 16681162) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is propan-2-yl 3-methyl-2-oxohex-5-enoate.
Molecular Properties
| Compound Name | propan-2-yl 3-methyl-2-oxohex-5-enoate |
| PubChem CID | 16681162 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | propan-2-yl 3-methyl-2-oxohex-5-enoate |
| SMILES | C=CCC(C)C(=O)C(=O)OC(C)C |
| InChI | InChI=1S/C10H16O3/c1-5-6-8(4)9(11)10(12)13-7(2)3/h5,7-8H,1,6H2,2-4H3 |
| InChIKey | JLPDXHOZUHBLDV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 3-methyl-2-oxohex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 3-methyl-2-oxohex-5-enoate?
The IUPAC name of propan-2-yl 3-methyl-2-oxohex-5-enoate (CID 16681162) is propan-2-yl 3-methyl-2-oxohex-5-enoate.
What is the SMILES notation for propan-2-yl 3-methyl-2-oxohex-5-enoate?
The canonical SMILES for propan-2-yl 3-methyl-2-oxohex-5-enoate is C=CCC(C)C(=O)C(=O)OC(C)C.
What is the InChIKey of propan-2-yl 3-methyl-2-oxohex-5-enoate?
The InChIKey is JLPDXHOZUHBLDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-5-6-8(4)9(11)10(12)13-7(2)3/h5,7-8H,1,6H2,2-4H3.
What are the key properties of propan-2-yl 3-methyl-2-oxohex-5-enoate?
propan-2-yl 3-methyl-2-oxohex-5-enoate has a molecular weight of 184.23 g/mol, XLogP of 1.72, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 3-methyl-2-oxohex-5-enoate is sourced from PubChem (CID 16681162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).