C19H30N2O5 — CID 166811694
tert-butyl (3aR,6R,8aS)-6-ethyl-7-[(2S)-1-methoxy-1-oxopropan-2-yl]-8-oxo-3,3a,6,8a-tetrahydro-2H-pyrrolo[2,3-c]azepine-1-carboxylate (PubChem CID 166811694) has the molecular formula C19H30N2O5 and a molecular weight of 366.46 g/mol. Its IUPAC name is tert-butyl (3aR,6R,8aS)-6-ethyl-7-[(2S)-1-methoxy-1-oxopropan-2-yl]-8-oxo-3,3a,6,8a-tetrahydro-2H-pyrrolo[2,3-c]azepine-1-carboxylate.
| Compound Name | tert-butyl (3aR,6R,8aS)-6-ethyl-7-[(2S)-1-methoxy-1-oxopropan-2-yl]-8-oxo-3,3a,6,8a-tetrahydro-2H-pyrrolo[2,3-c]azepine-1-carboxylate |
|---|---|
| PubChem CID | 166811694 |
| Molecular Formula | C19H30N2O5 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | tert-butyl (3aR,6R,8aS)-6-ethyl-7-[(2S)-1-methoxy-1-oxopropan-2-yl]-8-oxo-3,3a,6,8a-tetrahydro-2H-pyrrolo[2,3-c]azepine-1-carboxylate |
| SMILES | CC[C@@H]1C=C[C@H]2CCN(C(=O)OC(C)(C)C)[C@@H]2C(=O)N1[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C19H30N2O5/c1-7-14-9-8-13-10-11-20(18(24)26-19(3,4)5)15(13)16(22)21(14)12(2)17(23)25-6/h8-9,12-15H,7,10-11H2,1-6H3/t12-,13-,14+,15-/m0/s1 |
| InChIKey | QPHLFYOSOJPLHL-XQLPTFJDSA-N |
| XLogP | 2.35 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|