C32H48FNS — CID 166811784
(6Z,8Z,10E)-N-(1-cyclohexa-1,5-dien-1-yl-3-methylbut-3-en-2-yl)-8-[[fluoro(dimethyl)-λ4-sulfanyl]methyl]-10,11,13-trimethyl-5-methylidenetetradeca-1,6,8,10,12-pentaen-2-amine (PubChem CID 166811784) has the molecular formula C32H48FNS and a molecular weight of 497.81 g/mol. Its IUPAC name is (6Z,8Z,10E)-N-(1-cyclohexa-1,5-dien-1-yl-3-methylbut-3-en-2-yl)-8-[[fluoro(dimethyl)-λ4-sulfanyl]methyl]-10,11,13-trimethyl-5-methylidenetetradeca-1,6,8,10,12-pentaen-2-amine.
| Compound Name | (6Z,8Z,10E)-N-(1-cyclohexa-1,5-dien-1-yl-3-methylbut-3-en-2-yl)-8-[[fluoro(dimethyl)-λ4-sulfanyl]methyl]-10,11,13-trimethyl-5-methylidenetetradeca-1,6,8,10,12-pentaen-2-amine |
|---|---|
| PubChem CID | 166811784 |
| Molecular Formula | C32H48FNS |
| Molecular Weight | 497.81 g/mol |
| Exact Mass | 497.35 |
| IUPAC Name | (6Z,8Z,10E)-N-(1-cyclohexa-1,5-dien-1-yl-3-methylbut-3-en-2-yl)-8-[[fluoro(dimethyl)-λ4-sulfanyl]methyl]-10,11,13-trimethyl-5-methylidenetetradeca-1,6,8,10,12-pentaen-2-amine |
| SMILES | C=C(/C=C\C(=C\C(C)=C(/C)C=C(C)C)CS(C)(C)F)CCC(=C)NC(CC1=CCCC=C1)C(=C)C |
| InChI | InChI=1S/C32H48FNS/c1-24(2)20-27(6)28(7)21-31(23-35(9,10)33)19-17-26(5)16-18-29(8)34-32(25(3)4)22-30-14-12-11-13-15-30/h12,14-15,17,19-21,32,34H,3,5,8,11,13,16,18,22-23H2,1-2,4,6-7,9-10H3/b19-17-,28-27+,31-21- |
| InChIKey | TXIFNIBJHPQMAX-XZVCBUIBSA-N |
| XLogP | 9.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.81 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|