C15H20N2O4 — CID 166811805
5-(cyclohexa-1,5-dien-1-ylmethoxymethyl)-N-(3-hydroxypropyl)-1,2-oxazole-3-carboxamide (PubChem CID 166811805) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is 5-(cyclohexa-1,5-dien-1-ylmethoxymethyl)-N-(3-hydroxypropyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(cyclohexa-1,5-dien-1-ylmethoxymethyl)-N-(3-hydroxypropyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 166811805 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 5-(cyclohexa-1,5-dien-1-ylmethoxymethyl)-N-(3-hydroxypropyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCCO)c1cc(COCC2=CCCC=C2)on1 |
| InChI | InChI=1S/C15H20N2O4/c18-8-4-7-16-15(19)14-9-13(21-17-14)11-20-10-12-5-2-1-3-6-12/h2,5-6,9,18H,1,3-4,7-8,10-11H2,(H,16,19) |
| InChIKey | GVRBROBDDAURQK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|